CAS 82717-30-4
:decahydroisoquinoline-3-carboxylic acid
Description:
Decahydroisoquinoline-3-carboxylic acid is a bicyclic organic compound characterized by its unique structure, which includes a decahydroisoquinoline framework and a carboxylic acid functional group. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents, such as water and alcohols, due to the presence of the carboxylic acid group. Its molecular structure contributes to its potential biological activity, making it of interest in medicinal chemistry and drug development. The compound may participate in various chemical reactions, including esterification and amidation, due to the reactive carboxylic acid group. Additionally, it may serve as a building block in the synthesis of more complex molecules. Safety data indicates that, like many organic compounds, it should be handled with care, following appropriate safety protocols to minimize exposure. Overall, decahydroisoquinoline-3-carboxylic acid is a compound of interest for its structural properties and potential applications in pharmaceuticals.
Formula:C10H17NO2
InChI:InChI=1/C10H17NO2/c12-10(13)9-5-7-3-1-2-4-8(7)6-11-9/h7-9,11H,1-6H2,(H,12,13)
Synonyms:- Decanhydroisoquinoline-3-carboxylic acid
- 82717-30-4
- Decahydroisoquinoline-3-carboxylic acid
- Decahydro-3-isoquinolinecarboxylic acid
- 3-isoquinolinecarboxylic acid, decahydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
