CAS 82717-90-6

Phenylmethyl octahydro-1H-indole-2-carboxylate

Description:

Phenylmethyl octahydro-1H-indole-2-carboxylate, with the CAS number 82717-90-6, is a chemical compound that belongs to the class of indole derivatives. It features a bicyclic structure that includes an indole moiety, which is known for its presence in various natural products and pharmaceuticals. The compound is characterized by its ester functional group, which contributes to its chemical reactivity and potential applications in organic synthesis. Typically, such compounds may exhibit biological activity, making them of interest in medicinal chemistry. The presence of the phenylmethyl group suggests potential interactions with biological targets, while the octahydro structure indicates saturation, which can influence the compound's stability and solubility. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the environment in which it is studied. Overall, phenylmethyl octahydro-1H-indole-2-carboxylate represents a versatile structure with potential implications in various fields, including pharmaceuticals and materials science.

Formula: C₁₆H₂₁NO₂

InChI: InChI=1S/C16H21NO2/c18-16(19-11-12-6-2-1-3-7-12)15-10-13-8-4-5-9-14(13)17-15/h1-3,6-7,13-15,17H,4-5,8-11H2

InChI key: InChIKey=ARGCRCXTJMQKNA-UHFFFAOYSA-N

SMILES: C(OCC1=CC=CC=C1)(=O)C2CC3C(N2)CCCC3

Synonyms:

• 1H-Indole-2-carboxylic acid, octahydro-, phenylmethyl ester
• Phenylmethyl octahydro-1H-indole-2-carboxylate