CAS 827318-97-8
:Danusertib
Description:
Danusertib, with the CAS number 827318-97-8, is a small molecule inhibitor primarily targeting the Aurora kinase family, which plays a crucial role in cell division and mitosis. This compound is characterized by its ability to interfere with the phosphorylation of specific substrates involved in the cell cycle, thereby exhibiting potential anti-cancer properties. Danusertib has been studied for its efficacy against various types of tumors, particularly those that are resistant to conventional therapies. Its chemical structure includes a core that allows for selective binding to the ATP-binding site of Aurora kinases, which is essential for its inhibitory action. Additionally, Danusertib has shown promise in preclinical and clinical trials, demonstrating a favorable pharmacokinetic profile and the ability to induce apoptosis in cancer cells. However, like many targeted therapies, its effectiveness can vary based on the specific genetic and molecular characteristics of the tumor being treated. Ongoing research continues to explore its full therapeutic potential and the mechanisms underlying its action.
Formula:C26H30N6O3
InChI:InChI=1/C26H30N6O3/c1-30-12-14-31(15-13-30)20-10-8-19(9-11-20)25(33)27-24-21-16-32(17-22(21)28-29-24)26(34)23(35-2)18-6-4-3-5-7-18/h3-11,23H,12-17H2,1-2H3,(H2,27,28,29,33)/t23-/m1/s1
SMILES:CN1CCN(CC1)c1ccc(cc1)C(=Nc1c2CN(Cc2[nH]n1)C(=O)[C@@H](c1ccccc1)OC)O
Synonyms:- N-[5-((2R)-2-Methoxy-2-phenylethanoyl)-1,4,5,6-tetrahydropyrrolo[3,4-c]pyrazol-3-yl]-4-(4-methylpiperazin-1-yl)benzamide
- N-{5-[(2R)-2-methoxy-2-phenylacetyl]-1,4,5,6-tetrahydropyrrolo[3,4-c]pyrazol-3-yl}-4-(4-methylpiperazin-1-yl)benzamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
N-[5-((2R)-2-Methoxy-2-phenylethanoyl)-1,4,5,6-tetrahydropyrrolo[3,4-c]pyrazol-3-yl]-4-(4-methylpiperazin-1-yl)benzamide
CAS:Formula:C26H30N6O3Purity:%Color and Shape:SolidMolecular weight:474.5548(R)-N-(5-(2-Methoxy-2-Phenylacetyl)-1,4,5,6-Tetrahydropyrrolo[3,4-c]Pyrazol-3-Yl)-4-(4-Methylpiperazin-1-Yl)Benzamide
CAS:(R)-N-(5-(2-Methoxy-2-Phenylacetyl)-1,4,5,6-Tetrahydropyrrolo[3,4-c]Pyrazol-3-Yl)-4-(4-Methylpiperazin-1-Yl)BenzamidePurity:99+%Molecular weight:474.55g/molDanusertib
CAS:Danusertib (PHA-739358) is a small-molecule 3-aminopyrazole derivative with potential antineoplastic activity.Formula:C26H30N6O3Purity:97.88% - 98.79%Color and Shape:White PowderMolecular weight:474.55Danusertib
CAS:Inhibitor of aurora kinases
Formula:C26H30N6O3Purity:Min. 95%Color and Shape:White PowderMolecular weight:474.57 g/molDanusertib
CAS:Applications An Aurora kinase inhibitor, used to treat patients with chromic myeloid leukemia. It is a COVID19-related research product.
References Fancelli, D., et al.: J. Med. Chem., 49, 7247 (2006), Carpinelli, P., et al.: Mol. Canc. Ther., 6, 3158 (2007), Coumar, M., et al.: J. Med. Chem., 52, 1050 (2009),Formula:C26H30N6O3Color and Shape:NeatMolecular weight:474.55





