CAS 827327-99-1
:2-methoxy-N-(3-methoxybenzyl)ethanamine
Description:
2-Methoxy-N-(3-methoxybenzyl)ethanamine, identified by its CAS number 827327-99-1, is an organic compound characterized by its amine functional group and methoxy substituents. This compound features a two-carbon ethylamine backbone, with a methoxy group attached to the second carbon and a 3-methoxybenzyl group linked to the nitrogen atom. The presence of methoxy groups enhances its solubility in organic solvents and may influence its biological activity. The compound is likely to exhibit moderate polarity due to the combination of hydrophobic aromatic and hydrophilic methoxy groups. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar structures often interact with biological targets. Additionally, the presence of the amine group may allow for further derivatization, making it a versatile building block in organic synthesis. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity.
Formula:C11H17NO2
InChI:InChI=1/C11H17NO2/c1-13-7-6-12-9-10-4-3-5-11(8-10)14-2/h3-5,8,12H,6-7,9H2,1-2H3
SMILES:COCCNCc1cccc(c1)OC
Synonyms:- benzenemethanamine, 3-methoxy-N-(2-methoxyethyl)-
- 2-Methoxy-N-(3-methoxybenzyl)ethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.