CAS 827328-12-1
:N-(4-ethylbenzyl)-2-methoxyethanamine
Description:
N-(4-ethylbenzyl)-2-methoxyethanamine, identified by its CAS number 827328-12-1, is an organic compound characterized by its amine functional group and ether linkage. This substance features a 2-methoxyethanamine backbone, which contributes to its potential solubility in polar solvents, while the 4-ethylbenzyl substituent enhances its hydrophobic characteristics. The presence of the ethyl group on the benzyl ring can influence its steric properties and reactivity. As an amine, it may participate in various chemical reactions, including alkylation and acylation, and can act as a nucleophile. The methoxy group can also engage in hydrogen bonding, affecting the compound's physical properties such as boiling point and melting point. Due to its structural features, this compound may have applications in pharmaceuticals or as an intermediate in organic synthesis. However, specific biological activities, toxicity, and regulatory status would require further investigation to fully understand its implications in various fields.
Formula:C12H19NO
InChI:InChI=1/C12H19NO/c1-3-11-4-6-12(7-5-11)10-13-8-9-14-2/h4-7,13H,3,8-10H2,1-2H3
SMILES:CCc1ccc(cc1)CNCCOC
Synonyms:- benzenemethanamine, 4-ethyl-N-(2-methoxyethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.