CymitQuimica logo

CAS 827328-38-1

:

N-(4-fluorobenzyl)-2-methoxyethanamine

Description:
N-(4-fluorobenzyl)-2-methoxyethanamine, with the CAS number 827328-38-1, is a chemical compound characterized by its unique structure, which includes a fluorobenzyl group and a methoxyethanamine moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds due to the presence of the amine functional group. The fluorobenzyl substituent can influence its lipophilicity and biological activity, potentially enhancing its interaction with biological targets. The methoxy group contributes to the compound's overall polarity and solubility in organic solvents. In terms of applications, compounds with similar structures are often explored in medicinal chemistry for their potential therapeutic effects, particularly in the development of pharmaceuticals. Safety and handling considerations are essential, as with any chemical substance, and proper laboratory protocols should be followed when working with this compound. Overall, N-(4-fluorobenzyl)-2-methoxyethanamine represents a class of compounds that may have significant implications in research and drug development.
Formula:C10H14FNO
InChI:InChI=1/C10H14FNO/c1-13-7-6-12-8-9-2-4-10(11)5-3-9/h2-5,12H,6-8H2,1H3
SMILES:COCCNCc1ccc(cc1)F
Synonyms:
  • benzenemethanamine, 4-fluoro-N-(2-methoxyethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.