CAS 827328-39-2
:4-Chloro-N-(2-methoxyethyl)benzenemethanamine
Description:
4-Chloro-N-(2-methoxyethyl)benzenemethanamine, identified by its CAS number 827328-39-2, is an organic compound characterized by its aromatic structure and functional groups. It features a chlorobenzene ring, which contributes to its reactivity and potential applications in various chemical reactions. The presence of the methoxyethyl group enhances its solubility in organic solvents and may influence its biological activity. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can affect its interaction with other molecules. Additionally, the chlorine substituent can impart unique electronic properties, potentially making it useful in medicinal chemistry or as an intermediate in the synthesis of more complex compounds. Safety and handling considerations are essential, as with many organic chemicals, due to potential toxicity or reactivity. Overall, 4-Chloro-N-(2-methoxyethyl)benzenemethanamine represents a versatile structure in organic synthesis and pharmaceutical development.
Formula:C10H14ClNO
InChI:InChI=1S/C10H14ClNO/c1-13-7-6-12-8-9-2-4-10(11)5-3-9/h2-5,12H,6-8H2,1H3
InChI key:InChIKey=YAKIFYDDSQOBAF-UHFFFAOYSA-N
SMILES:C(NCCOC)C1=CC=C(Cl)C=C1
Synonyms:- 4-Chloro-N-(2-methoxyethyl)benzenemethanamine
- [(4-Chlorophenyl)methyl](2-methoxyethyl)amine
- benzenemethanamine, 4-chloro-N-(2-methoxyethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.