CAS 827328-61-0
:2-methoxy-N-(4-methylbenzyl)ethanamine
Description:
2-Methoxy-N-(4-methylbenzyl)ethanamine, identified by its CAS number 827328-61-0, is an organic compound characterized by its amine functional group and ether linkage. This substance features a methoxy group (-OCH3) attached to an ethylamine backbone, which is further substituted with a 4-methylbenzyl group. The presence of the methoxy group contributes to its potential solubility in organic solvents, while the amine group may impart basic properties. The compound's structure suggests it could participate in various chemical reactions typical of amines, such as alkylation or acylation. Additionally, the aromatic 4-methylbenzyl substituent may influence its biological activity and interactions, making it of interest in medicinal chemistry. The compound's molecular characteristics, including its molecular weight and specific functional groups, can affect its reactivity, stability, and potential applications in pharmaceuticals or as a chemical intermediate. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C11H17NO
InChI:InChI=1/C11H17NO/c1-10-3-5-11(6-4-10)9-12-7-8-13-2/h3-6,12H,7-9H2,1-2H3
SMILES:Cc1ccc(cc1)CNCCOC
Synonyms:- benzenemethanamine, N-(2-methoxyethyl)-4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.