CAS 827328-67-6
:N-(4-ethoxybenzyl)-2-methoxyethanamine
Description:
N-(4-ethoxybenzyl)-2-methoxyethanamine is an organic compound characterized by its amine functional group, which is indicative of its potential as a building block in medicinal chemistry. The presence of the ethoxy and methoxy groups suggests that it may exhibit interesting solubility and reactivity properties, making it suitable for various applications in pharmaceuticals or organic synthesis. The compound's structure includes a benzyl moiety, which can enhance its lipophilicity, potentially influencing its biological activity and interaction with biological targets. Additionally, the amine group may participate in hydrogen bonding, affecting its pharmacokinetic properties. As with many organic compounds, the specific characteristics such as melting point, boiling point, and solubility would depend on the molecular interactions and the environment in which the compound is studied. Safety and handling considerations are essential, as with any chemical substance, particularly those with amine functionalities, which can be reactive and may require appropriate safety measures during handling and experimentation.
Formula:C12H19NO2
InChI:InChI=1/C12H19NO2/c1-3-15-12-6-4-11(5-7-12)10-13-8-9-14-2/h4-7,13H,3,8-10H2,1-2H3
SMILES:CCOc1ccc(cc1)CNCCOC
Synonyms:- benzenemethanamine, 4-ethoxy-N-(2-methoxyethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.