CAS 82735-70-4

(2Z)-3-(3-Hydroxyphenyl)-2-propenoic acid

Description:

(2Z)-3-(3-Hydroxyphenyl)-2-propenoic acid, commonly known as trans-cinnamic acid derivative, is an organic compound characterized by its phenolic structure and unsaturated carboxylic acid functionality. It features a double bond between the second and third carbon atoms, contributing to its reactivity and potential for various chemical transformations. The presence of the hydroxyl group on the aromatic ring enhances its solubility in polar solvents and may influence its biological activity. This compound is typically a white to light yellow solid at room temperature and is known for its potential applications in pharmaceuticals, cosmetics, and as a flavoring agent due to its pleasant aroma. Additionally, it may exhibit antioxidant properties, making it of interest in food preservation and health-related studies. Its molecular structure allows for various interactions, including hydrogen bonding, which can affect its stability and reactivity in different environments. Overall, (2Z)-3-(3-Hydroxyphenyl)-2-propenoic acid is a versatile compound with significant implications in both industrial and research settings.

Formula: C₉H₈O₃

InChI: InChI=1S/C9H8O3/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-6,10H,(H,11,12)/b5-4-

InChI key: InChIKey=KKSDGJDHHZEWEP-PLNGDYQASA-N

SMILES: C(=C\C(O)=O)\C1=CC(O)=CC=C1

Synonyms:

• (2Z)-3-(3-Hydroxyphenyl)-2-propenoic acid
• cis-m-Coumaric acid
• 2-Propenoic acid, 3-(3-hydroxyphenyl)-, (2Z)-
• 2-Propenoic acid, 3-(3-hydroxyphenyl)-, (Z)-