CymitQuimica logo

CAS 82737-61-9

:

davy-reagent methyl

Description:
Davy-reagent methyl, identified by its CAS number 82737-61-9, is a chemical compound that serves as a reagent in various organic synthesis applications. It is primarily known for its role in the reduction of functional groups, particularly in the conversion of carbonyl compounds to their corresponding alcohols. This reagent is characterized by its ability to selectively reduce certain types of bonds while leaving others intact, making it valuable in synthetic organic chemistry. Davy-reagent methyl is typically used in controlled laboratory settings due to its reactivity and potential hazards. It is important to handle this substance with care, following appropriate safety protocols, as it may pose risks such as flammability or toxicity. The compound's specific physical and chemical properties, such as boiling point, melting point, and solubility, are essential for determining its suitability for particular reactions and applications. As with any chemical reagent, proper storage and disposal methods should be adhered to in order to ensure safety and compliance with regulatory standards.
Formula:C2H6P2S6
InChI:InChI=1/C2H6P2S6/c1-7-3(5)9-4(6,8-2)10-3/h1-2H3
SMILES:CSP1(=S)SP(=S)(SC)S1
Synonyms:
  • Davy
  • 2,4-Bis(Methylsulfanyl)-1,3,2,4-Dithiadiphosphetane 2,4-Disulfide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.