CAS 82747-40-8

7-Hydroxy-8-methyl-4-(trifluoromethyl)-2H-1-benzopyran-2-one

Description:

7-Hydroxy-8-methyl-4-(trifluoromethyl)-2H-1-benzopyran-2-one, with the CAS number 82747-40-8, is a synthetic organic compound belonging to the class of flavonoids. This compound features a benzopyran structure, characterized by a fused benzene and pyran ring, which contributes to its biological activity. The presence of a hydroxyl group at the 7-position and a methyl group at the 8-position enhances its solubility and reactivity. The trifluoromethyl group at the 4-position significantly influences its electronic properties, making it a subject of interest in medicinal chemistry for potential pharmacological applications. This compound may exhibit antioxidant, anti-inflammatory, and anticancer properties, typical of many flavonoids. Its unique structure allows for various interactions with biological targets, which can be explored in drug development. Additionally, its stability and reactivity can be influenced by environmental factors, making it important to consider these aspects in practical applications. Overall, 7-Hydroxy-8-methyl-4-(trifluoromethyl)-2H-1-benzopyran-2-one represents a valuable compound for research in both organic chemistry and pharmacology.

Formula: C₁₁H₇F₃O₃

InChI: InChI=1S/C11H7F3O3/c1-5-8(15)3-2-6-7(11(12,13)14)4-9(16)17-10(5)6/h2-4,15H,1H3

InChI key: InChIKey=LMPLCARGCBBRAW-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C=2C(=C(C)C(O)=CC2)OC(=O)C1

Synonyms:

• 2H-1-Benzopyran-2-one, 7-hydroxy-8-methyl-4-(trifluoromethyl)-
• 7-Hydroxy-8-methyl-4-(trifluoromethyl)-2H-1-benzopyran-2-one