
CAS 827588-49-8
:2-Amino-N,N-dimethyl-4-thiazolecarboxamide
Description:
2-Amino-N,N-dimethyl-4-thiazolecarboxamide, identified by its CAS number 827588-49-8, is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features an amino group and two methyl groups attached to the nitrogen atom, contributing to its N,N-dimethyl designation. The carboxamide functional group indicates the presence of a carbonyl group (C=O) bonded to a nitrogen atom, which is characteristic of amides. The thiazole moiety imparts unique properties, including potential biological activity, making it of interest in pharmaceutical research. The compound is typically solid at room temperature and may exhibit solubility in polar solvents due to the presence of the amino and carboxamide groups. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. As with many thiazole derivatives, it may also exhibit properties such as antimicrobial or antifungal activity, although specific biological activities would require empirical investigation.
Formula:C6H9N3OS
InChI:InChI=1S/C6H9N3OS/c1-9(2)5(10)4-3-11-6(7)8-4/h3H,1-2H3,(H2,7,8)
InChI key:InChIKey=MZOQQOSGXMKUGW-UHFFFAOYSA-N
SMILES:C(N(C)C)(=O)C1=CSC(N)=N1
Synonyms:- 2-Amino-N,N-dimethyl-1,3-thiazole-4-carboxamide
- 2-Aminothiazole-4-carboxylic acid dimethylamide
- 4-Thiazolecarboxamide, 2-amino-N,N-dimethyl-
- 2-Amino-N,N-dimethyl-4-thiazolecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.