CAS 827588-51-2

5-[(4-Chloro-3-methylphenoxy)methyl]-2-furancarboxylic acid hydrazide

Description:

5-[(4-Chloro-3-methylphenoxy)methyl]-2-furancarboxylic acid hydrazide, with the CAS number 827588-51-2, is a chemical compound characterized by its unique structure that includes a furan ring, a hydrazide functional group, and a chlorinated aromatic moiety. This compound typically exhibits properties associated with both hydrazides and aromatic compounds, such as potential reactivity in condensation reactions and the ability to form hydrogen bonds due to the presence of the hydrazide group. The chlorinated phenoxy component may impart specific biological activity or enhance solubility in organic solvents. Additionally, the furan ring contributes to the compound's stability and may influence its electronic properties. Such compounds are often of interest in medicinal chemistry and agricultural applications, where they may serve as intermediates or active ingredients. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, as the presence of chlorine and other functional groups can affect the compound's safety profile.

Formula: C₁₃H₁₃ClN₂O₃

InChI: InChI=1S/C13H13ClN2O3/c1-8-6-9(2-4-11(8)14)18-7-10-3-5-12(19-10)13(17)16-15/h2-6H,7,15H2,1H3,(H,16,17)

InChI key: InChIKey=QQKAMNOABKWTGI-UHFFFAOYSA-N

SMILES: C(OC1=CC(C)=C(Cl)C=C1)C=2OC(C(NN)=O)=CC2

Synonyms:

• 5-[(4-Chloro-3-methylphenoxy)methyl]-2-furancarboxylic acid hydrazide
• 2-Furancarboxylic acid, 5-[(4-chloro-3-methylphenoxy)methyl]-, hydrazide