
CAS 827588-52-3
:2-Amino-N-[2-(dimethylamino)ethyl]-4-thiazolecarboxamide
Description:
2-Amino-N-[2-(dimethylamino)ethyl]-4-thiazolecarboxamide, identified by its CAS number 827588-52-3, is a chemical compound that features a thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound is characterized by the presence of an amino group and a carboxamide functional group, contributing to its potential as a bioactive molecule. The dimethylamino group enhances its solubility and may influence its pharmacological properties. Typically, compounds of this nature are investigated for their biological activities, including antimicrobial or anticancer properties, due to the presence of the thiazole moiety, which is known for its diverse biological applications. The molecular structure suggests that it may engage in hydrogen bonding and other interactions, making it a candidate for further research in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.
Formula:C8H14N4OS
InChI:InChI=1S/C8H14N4OS/c1-12(2)4-3-10-7(13)6-5-14-8(9)11-6/h5H,3-4H2,1-2H3,(H2,9,11)(H,10,13)
InChI key:InChIKey=QRKOQLDFVQSHON-UHFFFAOYSA-N
SMILES:C(NCCN(C)C)(=O)C=1N=C(N)SC1
Synonyms:- 4-Thiazolecarboxamide, 2-amino-N-[2-(dimethylamino)ethyl]-
- 2-Amino-N-[2-(dimethylamino)ethyl]-1,3-thiazole-4-carboxamide
- 2-Amino-N-[2-(dimethylamino)ethyl]-4-thiazolecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.