CAS 827614-35-7
:4-Chloro-7-(4-methoxyphenyl)thieno[3,2-d]pyrimidine
Description:
4-Chloro-7-(4-methoxyphenyl)thieno[3,2-d]pyrimidine is a heterocyclic compound characterized by its complex structure, which includes a thieno[3,2-d]pyrimidine core. This compound features a chlorine atom at the 4-position and a para-methoxyphenyl group at the 7-position, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the chlorine and methoxy groups can influence its reactivity and interactions with biological targets, making it of interest in medicinal chemistry. This compound may exhibit biological activity, potentially serving as a lead compound in drug development, particularly in areas such as oncology or infectious diseases. Its molecular structure allows for various synthetic modifications, which can enhance its pharmacological profile. As with many heterocycles, it may also display interesting electronic properties due to the conjugated system within its structure. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory settings.
Formula:C13H9ClN2OS
InChI:InChI=1S/C13H9ClN2OS/c1-17-9-4-2-8(3-5-9)10-6-18-12-11(10)15-7-16-13(12)14/h2-7H,1H3
InChI key:InChIKey=YNNAGDCTUSMWFZ-UHFFFAOYSA-N
SMILES:ClC1=C2C(C(=CS2)C3=CC=C(OC)C=C3)=NC=N1
Synonyms:- Thieno[3,2-d]pyrimidine, 4-chloro-7-(4-methoxyphenyl)-
- 4-Chloro-7-(4-methoxyphenyl)thieno[3,2-d]pyrimidine
- 4-CHLORO-7-(4-METHOXY-PHENYL)-THIENO[3,2-D]-PYRIMIDINE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Chloro-7-(4-methoxy-phenyl)-thieno[3,2-d]-pyrimidine
CAS:Color and Shape:SolidMolecular weight:276.739990234375
