CAS 827614-47-1

1-(2,5-Dichlorophenyl)piperazine dihydrochloride

Description:

1-(2,5-Dichlorophenyl)piperazine dihydrochloride is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a dichlorophenyl group, specifically with chlorine substituents at the 2 and 5 positions of the phenyl ring, contributing to its unique chemical properties. It is typically encountered as a dihydrochloride salt, which enhances its solubility in water and other polar solvents. The presence of the piperazine moiety suggests potential biological activity, as piperazine derivatives are often explored for their pharmacological properties, including effects on the central nervous system. The compound may exhibit interactions with various receptors, making it of interest in medicinal chemistry and drug development. Its molecular structure and functional groups can influence its reactivity, stability, and potential applications in research or therapeutic contexts. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₀H₁₄Cl₄N₂

InChI: InChI=1/C10H12Cl2N2.2ClH/c11-8-1-2-9(12)10(7-8)14-5-3-13-4-6-14;;/h1-2,7,13H,3-6H2;2*1H

SMILES: c1cc(c(cc1Cl)N1CCNCC1)Cl.Cl.Cl

Synonyms:

• Piperazine, 1-(2,5-dichlorophenyl)-, hydrochloride (1:2)
• 1-(2,5-Dichlorophenyl)piperazine dihydrochloride

1-(2,5-Dichlorophenyl)piperazinedihydrochloride

Controlled Product

CAS: 827614-47-1

Please enquire for more information about 1-(2,5-Dichlorophenyl)piperazinedihydrochloride including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₀H₁₄Cl₄N₂

Purity: Min. 95%

Molecular weight: 304.04 g/mol

Ref: 3D-FD149447