CAS 827614-55-1

Piperazine, 1-[(3-nitrophenyl)methyl]-, hydrochloride (1:2)

Description:

Piperazine, 1-[(3-nitrophenyl)methyl]-, hydrochloride (1:2) is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine. The presence of a 3-nitrophenyl group indicates that the compound has a nitro substituent on the aromatic ring, which can influence its reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The compound may exhibit properties such as being a potential intermediate in organic synthesis or having specific pharmacological effects, given the structural motifs present. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, particularly those with nitro groups, which can be sensitive to reduction reactions. Overall, this compound represents a unique combination of piperazine and nitrophenyl functionalities, contributing to its potential applications in research and industry.

Formula: C₁₁H₁₅N₃O₂·2ClH

InChI: InChI=1S/C11H15N3O2.2ClH/c15-14(16)11-3-1-2-10(8-11)9-13-6-4-12-5-7-13;;/h1-3,8,12H,4-7,9H2;2*1H

InChI key: InChIKey=BGYFKQBZFDFBMO-UHFFFAOYSA-N

SMILES: C(C1=CC(N(=O)=O)=CC=C1)N2CCNCC2.Cl

Synonyms:

• Piperazine, 1-[(3-nitrophenyl)methyl]-, dihydrochloride
• Piperazine, 1-[(3-nitrophenyl)methyl]-, hydrochloride (1:2)
• 1-(3-Nitrobenzyl)piperazine dihydrochloride

1-(3-Nitrobenzyl)piperazine dihydrochloride

CAS: 827614-55-1

1-(3-Nitrobenzyl)piperazine dihydrochloride

Purity: ≥95%

Ref: 54-OR0226

1-(3-Nitrobenzyl)piperazine dihydrochloride

CAS: 827614-55-1

Versatile small molecule scaffold

Formula: C₁₁H₁₇Cl₂N₃O₂

Purity: Min. 95%

Molecular weight: 294.17 g/mol

Ref: 3D-CIB61455