CAS 82769-75-3

(S)-3-Dimethylamino-3-phenylpropanol

Description:

(S)-3-Dimethylamino-3-phenylpropanol, with the CAS number 82769-75-3, is an organic compound characterized by its chiral structure, which includes a dimethylamino group and a phenyl group attached to a propanol backbone. This compound typically exists as a colorless to pale yellow liquid and is soluble in water and various organic solvents, reflecting its polar nature due to the presence of the hydroxyl (-OH) group. The dimethylamino group contributes to its basicity, allowing it to participate in various chemical reactions, including nucleophilic substitutions and protonation. Its chirality can influence its biological activity, making it of interest in pharmaceutical applications, particularly in the development of drugs that target specific biological pathways. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, (S)-3-Dimethylamino-3-phenylpropanol is a versatile compound with potential applications in medicinal chemistry and organic synthesis.

Formula: C₁₁H₁₇NO

InChI: InChI=1/C11H17NO/c1-12(2)11(8-9-13)10-6-4-3-5-7-10/h3-7,11,13H,8-9H2,1-2H3/t11-/m0/s1

SMILES: CN(C)[C@@H](CCO)c1ccccc1

(S)-3-(Dimethylamino)-3-phenylpropan-1-ol

CAS: 82769-75-3

Formula: C₁₁H₁₇NO

Purity: 90%

Color and Shape: Liquid

Molecular weight: 179.2588

Ref: IN-DA0056K0

(S)-3-Dimethylamino-3-Phenylpropanol

CAS: 82769-75-3

(S)-3-Dimethylamino-3-Phenylpropanol

Purity: 90%

Molecular weight: 179.26g/mol

Ref: 54-OR1023482

Dapoxetine Impurity 21

CAS: 82769-75-3

Formula: C₁₁H₁₇NO

Molecular weight: 176.26

Ref: 4Z-D-2031

(S)-3-Dimethylamino-3-phenylpropanol

CAS: 82769-75-3

(S)-3-Dimethylamino-3-phenylpropanol is a racemic mixture of two enantiomers, (R)- and (S)-. It is a chiral molecule that is used in the production of dapoxetine hydrochloride, which is an antidepressant drug. The simulations were industrialized to produce this substance as a drug substance for the treatment of depression. The impurities were removed by using chromatography techniques, such as high performance liquid chromatography (HPLC). This process was carried out using an organic solvent that does not contain chloride gas or hydrogen chloride.

Formula: C₁₁H₁₇NO

Purity: Min. 95%

Color and Shape: Colorless Powder

Molecular weight: 179.26 g/mol

Ref: 3D-FD142888

(S)-3-(Dimethylamino)-3-phenylpropan-1-ol

CAS: 82769-75-3

Formula: C₁₁H₁₇NO

Purity: 90%(HPLC);RG

Molecular weight: 179.263

Ref: 10-F209808

Dapoxetine Hydrochloride Impurity 1

CAS: 82769-75-3

Formula: C₁₁H₁₇NO

Molecular weight: 179.3

Ref: ST-EA-CP-D9003