CymitQuimica logo

CAS 82770-40-9

:

benzyl N,N-dibenzyl-L-serinate

Description:
Benzyl N,N-dibenzyl-L-serinate is a chemical compound characterized by its structure, which includes a serine amino acid derivative with two benzyl groups attached to the nitrogen atom. This compound typically exhibits properties associated with both amino acids and aromatic compounds, such as solubility in organic solvents and potential bioactivity due to the presence of the serine moiety. The presence of the benzyl groups may enhance lipophilicity, influencing its interaction with biological membranes and potential pharmacological properties. Additionally, the compound may participate in various chemical reactions, including esterification and amide formation, due to the functional groups present. Its applications could range from use in pharmaceuticals to research in biochemical pathways, although specific applications may vary based on ongoing studies and discoveries. As with many organic compounds, safety and handling precautions should be observed, particularly regarding potential toxicity and reactivity.
Formula:C24H25NO3
InChI:InChI=1/C24H25NO3/c26-18-23(24(27)28-19-22-14-8-3-9-15-22)25(16-20-10-4-1-5-11-20)17-21-12-6-2-7-13-21/h1-15,23,26H,16-19H2/t23-/m0/s1
SMILES:c1ccc(cc1)CN(Cc1ccccc1)[C@@H](CO)C(=O)OCc1ccccc1
Synonyms:
  • 82770-40-9
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.