CAS 82777-09-1
:2'-Iodo-1,1':3',1''-terphenyl
Description:
2'-Iodo-1,1':3',1''-terphenyl, with the CAS number 82777-09-1, is an organic compound characterized by its structure, which consists of three phenyl rings connected in a specific arrangement, with an iodine atom substituted at the 2' position of one of the rings. This compound typically exhibits properties common to halogenated aromatic compounds, such as increased stability and potential for reactivity due to the presence of the iodine atom. It is generally insoluble in water but may dissolve in organic solvents like dichloromethane or toluene. The iodine substituent can influence the compound's electronic properties, making it useful in various applications, including organic synthesis and materials science. Additionally, 2'-iodo-1,1':3',1''-terphenyl may exhibit interesting photophysical properties, making it a candidate for studies in photonics or as a precursor in the synthesis of more complex organic molecules. Safety precautions should be taken when handling this compound, as with many halogenated organic substances, due to potential toxicity and environmental concerns.
Formula:C18H13I
InChI:InChI=1/C18H13I/c19-18-16(14-8-3-1-4-9-14)12-7-13-17(18)15-10-5-2-6-11-15/h1-13H
SMILES:c1ccc(cc1)c1cccc(c2ccccc2)c1I
Synonyms:- 1,1':3',1''-Terphenyl, 2'-Iodo-
- 2'-Iodo-1,1':3',1''-terphenyl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2'-Iodo-m-terphenyl
CAS:Formula:C18H13IPurity:>98.0%(GC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:356.212'-Iodo-1,1':3',1″-terphenyl, 99%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C18H13IPurity:99%Color and Shape:White to pale cream, Crystals or powder or crystalline powderMolecular weight:356.212'-Iodo-1,1':3',1''-terphenyl
CAS:2'-Iodo-1,1':3',1''-terphenylPurity:99%Molecular weight:356.20g/mol




