CAS 82780-78-7

4-Methoxy-2-nitro-1-(phenylmethoxy)benzene

Description:

4-Methoxy-2-nitro-1-(phenylmethoxy)benzene, with the CAS number 82780-78-7, is an organic compound characterized by its aromatic structure, which includes a methoxy group and a nitro group attached to a benzene ring. The presence of the methoxy group (-OCH3) enhances its solubility in organic solvents and can influence its reactivity, while the nitro group (-NO2) is known for its electron-withdrawing properties, which can affect the compound's electrophilic and nucleophilic behavior. This compound is typically used in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals or agrochemicals. Its molecular structure suggests potential applications in materials science and as a building block for more complex organic molecules. Safety data should be consulted, as nitro compounds can be hazardous, and appropriate handling and storage conditions are essential to ensure safety in laboratory settings.

Formula: C₁₄H₁₃NO₄

InChI: InChI=1/C14H13NO4/c1-18-12-7-8-14(13(9-12)15(16)17)19-10-11-5-3-2-4-6-11/h2-9H,10H2,1H3

SMILES: COc1ccc(c(c1)N(=O)=O)OCc1ccccc1

Synonyms:

• 1-(Benzyloxy)-4-methoxy-2-nitrobenzene
• Benzene, 4-Methoxy-2-Nitro-1-(Phenylmethoxy)-