
CAS 82784-82-5
:3,4-Dihydroxyphthalic acid
Description:
3,4-Dihydroxyphthalic acid, with the CAS number 82784-82-5, is an organic compound that belongs to the class of phthalic acids. It features two hydroxyl (-OH) groups located at the 3 and 4 positions of the phthalic acid structure, which contributes to its chemical reactivity and solubility properties. This compound is typically a white to off-white crystalline solid and is soluble in water and various organic solvents, making it versatile for different applications. The presence of hydroxyl groups enhances its potential for hydrogen bonding, influencing its physical properties and reactivity. 3,4-Dihydroxyphthalic acid can be used in the synthesis of various chemical derivatives and may serve as an intermediate in the production of dyes, pharmaceuticals, and agrochemicals. Additionally, its structural characteristics allow it to participate in various chemical reactions, including esterification and oxidation, which are important in organic synthesis. Overall, 3,4-Dihydroxyphthalic acid is a valuable compound in both research and industrial applications.
Formula:C8H6O6
InChI:InChI=1S/C8H6O6/c9-4-2-1-3(7(11)12)5(6(4)10)8(13)14/h1-2,9-10H,(H,11,12)(H,13,14)
InChI key:InChIKey=QXGJCWSBOZXWOV-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C(O)=O)C=CC(O)=C1O
Synonyms:- 3,4-Dihydroxyphthalic acid
- 1,2-Benzenedicarboxylic acid, 3,4-dihydroxy-
- Phthalic acid, 3,4-dihydroxy-
- 3,4-Dihydroxy-1,2-benzenedicarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.