
CAS 82788-19-0
:Methyl 6-hydroxy-3-methylbenzo[b]thiophene-2-carboxylate
Description:
Methyl 6-hydroxy-3-methylbenzo[b]thiophene-2-carboxylate, with the CAS number 82788-19-0, is an organic compound characterized by its complex structure that includes a thiophene ring fused to a benzene derivative. This compound features a carboxylate ester functional group, which contributes to its reactivity and solubility properties. The presence of hydroxyl and methyl groups indicates potential for hydrogen bonding and influences its physical properties, such as boiling and melting points. Typically, compounds of this nature exhibit moderate to high lipophilicity, making them soluble in organic solvents while being less soluble in water. The thiophene moiety often imparts unique electronic properties, which can be beneficial in applications such as organic electronics or as intermediates in synthetic chemistry. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Overall, Methyl 6-hydroxy-3-methylbenzo[b]thiophene-2-carboxylate is a versatile compound with potential applications across various fields of chemistry and material science.
Formula:C11H10O3S
InChI:InChI=1S/C11H10O3S/c1-6-8-4-3-7(12)5-9(8)15-10(6)11(13)14-2/h3-5,12H,1-2H3
InChI key:InChIKey=JYXLBGHYQHYJGK-UHFFFAOYSA-N
SMILES:CC=1C=2C(SC1C(OC)=O)=CC(O)=CC2
Synonyms:- Benzo[b]thiophene-2-carboxylic acid, 6-hydroxy-3-methyl-, methyl ester
- Methyl 6-hydroxy-3-methylbenzo[b]thiophene-2-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.