CAS 82789-18-2
:1-phenyl-2,3,4,9-tetrahydro-1H-beta-carboline-3-carboxylic acid
Description:
1-Phenyl-2,3,4,9-tetrahydro-1H-beta-carboline-3-carboxylic acid, with the CAS number 82789-18-2, is a chemical compound that belongs to the beta-carboline family, which is characterized by a bicyclic structure containing a fused indole and pyridine ring. This compound exhibits a range of biological activities, including potential neuroprotective and antidepressant effects, making it of interest in pharmacological research. Its structure features a phenyl group, which can influence its interaction with biological targets, and a carboxylic acid functional group that may enhance its solubility and reactivity. The tetrahydro configuration indicates that the compound is partially saturated, which can affect its stability and reactivity. Additionally, beta-carbolines are known to interact with various neurotransmitter systems, including serotonin and dopamine pathways, contributing to their psychoactive properties. Overall, this compound's unique structural features and biological relevance make it a subject of interest in medicinal chemistry and drug development.
Formula:C18H16N2O2
InChI:InChI=1/C18H16N2O2/c21-18(22)15-10-13-12-8-4-5-9-14(12)19-17(13)16(20-15)11-6-2-1-3-7-11/h1-9,15-16,19-20H,10H2,(H,21,22)
SMILES:c1ccc(cc1)C1c2c(CC(C(=O)O)N1)c1ccccc1[nH]2
Synonyms:- 1H-Pyrido[3,4-b]indole-3-carboxylic acid, 2,3,4,9-tetrahydro-1-phenyl-
- 1-Phenyl-2,3,4,9-tetrahydro-1H-b-carboline-3-carboxylic acid
- 1-Phenyl-2,3,4,9-tetrahydro-1H-beta-carboline-3-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1-Phenyl-2,3,4,9-tetrahydro-1H-beta-carboline-3-carboxylic acid
CAS:1-Phenyl-2,3,4,9-tetrahydro-1H-beta-carboline-3-carboxylic acid (1PC) is a potent inhibitor of HIV RNA polymerase that has been shown to be active against HIV in cell culture. 1PC is a ligand for the HIV transcriptase and binds to the enzyme's active site. 1PC prevents the formation of the RNA primer needed for transcription by binding to the primer binding site on the enzyme. The compound also inhibits nonnucleoside reverse transcriptase inhibitors, such as zidovudine and lamivudine. This inhibition is through competitive inhibition at the active site of the enzyme and not through covalent bonding to an amino acid residue on the protein. 1PC also has antiviral activity against influenza virus A/WSN/33 (H1N1), human coronavirus 229E, human coronavirus OC43 (H2N2Formula:C18H16N2O2Purity:Min. 95%Molecular weight:292.34 g/mol
