CAS 82789-26-2

1-(1,3-Benzodioxol-5-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid

Description:

1-(1,3-Benzodioxol-5-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid, with the CAS number 82789-26-2, is a complex organic compound characterized by its unique bicyclic structure that incorporates both indole and pyridine moieties. This compound features a benzodioxole group, which contributes to its potential biological activity and pharmacological properties. It is typically a solid at room temperature and may exhibit solubility in organic solvents, depending on its specific functional groups. The presence of a carboxylic acid group suggests it can participate in acid-base reactions and may form salts or esters. Its structural complexity indicates potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. Additionally, compounds with similar structures are often investigated for their effects on the central nervous system, highlighting the importance of understanding their chemical behavior and reactivity in various environments. Further studies would be necessary to elucidate its specific properties and potential applications.

Formula: C₁₉H₁₆N₂O₄

InChI: InChI=1S/C19H16N2O4/c22-19(23)14-8-12-11-3-1-2-4-13(11)20-18(12)17(21-14)10-5-6-15-16(7-10)25-9-24-15/h1-7,14,17,20-21H,8-9H2,(H,22,23)

InChI key: InChIKey=MDXJJOKTGDJRNN-UHFFFAOYSA-N

SMILES: C(O)(=O)C1CC2=C(C(N1)C=3C=C4C(=CC3)OCO4)NC=5C2=CC=CC5

Synonyms:

• 1-Benzo[1,3]dioxol-5-yl-2,3,4,9-tetrahydro-1H-β-carboline-3-carboxylic acid
• 1H-Pyrido[3,4-b]indole-3-carboxylic acid, 1-(1,3-benzodioxol-5-yl)-2,3,4,9-tetrahydro-
• 1-(1,3-Benzodioxol-5-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid
• 1-(Benzo[d][1,3]dioxol-5-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid