CAS 82789-49-9

{[(2-chloro-1,1,2-trifluoroethyl)sulfanyl]methyl}benzene

Description:

The chemical substance known as {[(2-chloro-1,1,2-trifluoroethyl)sulfanyl]methyl}benzene, with the CAS number 82789-49-9, is an organosulfur compound characterized by the presence of a benzene ring substituted with a sulfanyl group and a trifluoroethyl moiety. This compound features a chlorine atom and three fluorine atoms attached to the carbon adjacent to the sulfur atom, contributing to its unique reactivity and physical properties. The presence of the trifluoroethyl group imparts significant electronegativity, which can influence the compound's behavior in chemical reactions, particularly in nucleophilic substitutions. The sulfanyl group introduces a sulfur atom, which can participate in various chemical transformations, making this compound of interest in synthetic organic chemistry. Additionally, the chlorinated and fluorinated substituents may enhance the compound's stability and alter its solubility in different solvents. Overall, this compound's structure suggests potential applications in pharmaceuticals, agrochemicals, or materials science, where specific electronic and steric properties are desirable.

Formula: C₉H₈ClF₃S

InChI: InChI=1/C9H8ClF3S/c10-8(11)9(12,13)14-6-7-4-2-1-3-5-7/h1-5,8H,6H2

SMILES: c1ccc(cc1)CSC(C(Cl)F)(F)F

Synonyms:

• Benzene, (((2-chloro-1,1,2-trifluoroethyl)thio)methyl)-