CymitQuimica logo

CAS 828-74-0

:

2,3,5,6-Tetrafluoro-4-(methylthio)benzenamine

Description:
2,3,5,6-Tetrafluoro-4-(methylthio)benzenamine is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with four fluorine atoms and a methylthio group. The presence of fluorine atoms significantly influences its chemical properties, enhancing its stability and reactivity. The methylthio group (-S-CH3) introduces a sulfur atom into the structure, which can participate in various chemical reactions, including nucleophilic substitutions. This compound is likely to be a solid at room temperature, given its aromatic nature and the presence of multiple electronegative fluorine atoms, which can increase intermolecular interactions. It may exhibit unique solubility characteristics, being more soluble in polar solvents due to the electronegative fluorine atoms. Additionally, the compound's potential applications could span various fields, including pharmaceuticals and agrochemicals, where fluorinated compounds are often sought for their enhanced biological activity and stability. Safety data should be consulted for handling, as fluorinated compounds can pose specific health and environmental risks.
Formula:C7H5F4NS
InChI:InChI=1S/C7H5F4NS/c1-13-7-4(10)2(8)6(12)3(9)5(7)11/h12H2,1H3
InChI key:InChIKey=XXOFJTLLHKQRPI-UHFFFAOYSA-N
SMILES:S(C)C1=C(F)C(F)=C(N)C(F)=C1F
Synonyms:
  • Aniline, 2,3,5,6-tetrafluoro-4-(methylthio)-
  • 2,3,5,6-Tetrafluoro-4-(methylsulfanyl)aniline
  • Benzenamine, 2,3,5,6-tetrafluoro-4-(methylthio)-
  • 2,3,5,6-Tetrafluoro-4-(methylthio)benzenamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.