CAS 82817-65-0

5-(acetylamino)pyridine-3-carboxylic acid

Description:

5-(Acetylamino)pyridine-3-carboxylic acid, with the CAS number 82817-65-0, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an acetylamino group and a carboxylic acid functional group, contributing to its chemical reactivity and potential applications. The presence of the acetylamino group enhances its solubility in polar solvents, while the carboxylic acid group can participate in acid-base reactions. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for various interactions, including hydrogen bonding, which can influence its behavior in biological systems. Additionally, the compound's properties, such as melting point, boiling point, and solubility, can vary based on environmental conditions and the presence of other substances. Overall, 5-(acetylamino)pyridine-3-carboxylic acid is a versatile compound with potential applications in medicinal chemistry and related fields.

Formula: C₈H₈N₂O₃

InChI: InChI=1/C8H8N2O3/c1-5(11)10-7-2-6(8(12)13)3-9-4-7/h2-4H,1H3,(H,10,11)(H,12,13)

SMILES: CC(=Nc1cc(cnc1)C(=O)O)O

Synonyms:

• 5-Acetamidonicotinic acid

5-Acetamidonicotinic acid

CAS: 82817-65-0

Formula: C₈H₈N₂O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 180.1607

Ref: IN-DA0036EP

5-Acetamidonicotinic acid

CAS: 82817-65-0

5-Acetamidonicotinic acid

Formula: C₈H₈N₂O₃

Purity: 98%

Color and Shape: off-white solid

Molecular weight: 180.16g/mol

Ref: 54-OR9469

5-Acetamidonicotinic acid

CAS: 82817-65-0

Formula: C₈H₈N₂O₃

Purity: ≥95%

Molecular weight: 180.163

Ref: 10-F209830