CAS 82820-30-2
:1-Phenyl-2-(pyrimidin-2-yl)ethanone
Description:
1-Phenyl-2-(pyrimidin-2-yl)ethanone, with the CAS number 82820-30-2, is an organic compound characterized by its ketone functional group and the presence of both phenyl and pyrimidine moieties. This compound typically appears as a solid or crystalline substance, exhibiting moderate solubility in organic solvents such as ethanol and dichloromethane, while being less soluble in water due to its hydrophobic characteristics. The presence of the pyrimidine ring contributes to its potential biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its reactivity and stability. Additionally, 1-Phenyl-2-(pyrimidin-2-yl)ethanone may exhibit unique optical properties, making it suitable for applications in materials science and organic electronics. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C12H10N2O
InChI:InChI=1/C12H10N2O/c15-11(10-5-2-1-3-6-10)9-12-13-7-4-8-14-12/h1-8H,9H2
SMILES:c1ccc(cc1)C(=O)Cc1ncccn1
Synonyms:- 2-(Benzoylmethyl)pyrimidine
- Ethanone, 1-Phenyl-2-(2-Pyrimidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
