CAS 82820-87-9
:2,4-Dibromobutanoyl chloride
Description:
2,4-Dibromobutanoyl chloride is an organic compound characterized by the presence of both bromine and acyl chloride functional groups. It features a four-carbon butanoyl chain with bromine atoms attached to the second and fourth carbon positions. This compound is typically a colorless to pale yellow liquid, exhibiting a pungent odor due to the acyl chloride group, which is reactive and can hydrolyze in the presence of moisture, releasing hydrochloric acid. It is soluble in organic solvents such as dichloromethane and ether but is not soluble in water. The presence of bromine atoms enhances its reactivity, making it useful in various synthetic applications, including the preparation of more complex organic molecules. Due to its reactivity, 2,4-dibromobutanoyl chloride should be handled with care, as it can cause irritation to the skin, eyes, and respiratory system. Proper safety precautions, including the use of personal protective equipment and working in a well-ventilated area or fume hood, are essential when working with this compound.
Formula:C4H5Br2ClO
InChI:InChI=1S/C4H5Br2ClO/c5-2-1-3(6)4(7)8/h3H,1-2H2
InChI key:InChIKey=WYZLYWUZERABRL-UHFFFAOYSA-N
SMILES:C(CCBr)(C(Cl)=O)Br
Synonyms:- 2,4-Dibromobutanoyl Chloride
- Butanoyl chloride, 2,4-dibromo-
- 2,4-Dibromobutyryl chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,4-Dibromobutyryl chloride
CAS:Formula:C4H5Br2ClOPurity:90%Color and Shape:LiquidMolecular weight:264.34292,4-Dibromobutanoyl chloride
CAS:2,4-Dibromobutanoyl chlorideFormula:C4H5Br2ClOPurity:90%Color and Shape: almost colourless liquidMolecular weight:264.34g/mol2,4-Dibromobutyryl chloride
CAS:2,4-Dibromobutyryl chloride is an enantiopure compound that can be used as a chemical building block in the synthesis of many other chemical compounds. It has been shown to have butyric acid mediated effects on diabetes and the condition of the esters. 2,4-Dibromobutyryl chloride has also been shown to have stereoselective effects on glucokinase and ketones.
Formula:C4H5Br2ClOPurity:90%MinMolecular weight:264.34 g/mol



