
CAS 82821-47-4
:N-(2-Hydroxyethyl)-α-methyl-4-(2-methylpropyl)benzeneacetamide
Description:
N-(2-Hydroxyethyl)-α-methyl-4-(2-methylpropyl)benzeneacetamide, with the CAS number 82821-47-4, is a chemical compound characterized by its amide functional group, which is derived from the reaction of an amine with a carboxylic acid. This substance features a hydroxyethyl group that enhances its solubility in polar solvents, while the α-methyl and isobutyl substituents contribute to its hydrophobic characteristics. The presence of the aromatic benzene ring provides stability and can influence the compound's reactivity and interaction with biological systems. Typically, compounds of this nature may exhibit properties such as moderate to high melting points, depending on their molecular structure and intermolecular forces. They may also demonstrate potential applications in pharmaceuticals or as intermediates in organic synthesis due to their unique structural features. However, specific physical and chemical properties such as boiling point, solubility, and reactivity would require empirical data for precise characterization. Safety data should also be consulted to understand any potential hazards associated with handling this compound.
Formula:C15H23NO2
InChI:InChI=1S/C15H23NO2/c1-11(2)10-13-4-6-14(7-5-13)12(3)15(18)16-8-9-17/h4-7,11-12,17H,8-10H2,1-3H3,(H,16,18)
InChI key:InChIKey=JVGUNCHERKJFCM-UHFFFAOYSA-N
SMILES:C(C(NCCO)=O)(C)C1=CC=C(CC(C)C)C=C1
Synonyms:- Mabuprofen
- Benzeneacetamide, N-(2-hydroxyethyl)-α-methyl-4-(2-methylpropyl)-, (±)-
- Benzeneacetamide, N-(2-hydroxyethyl)-α-methyl-4-(2-methylpropyl)-
- N-(2-Hydroxyethyl)-α-methyl-4-(2-methylpropyl)benzeneacetamide
- Aminoprofen
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Mabuprofen
CAS:<p>Mabuprofen is a nonsteroidal anti-inflammatory drug that belongs to the class of NSAIDs. It is used to treat pain, inflammation, and stiffness caused by osteoarthritis, rheumatoid arthritis, and other joint diseases. Mabuprofen is a prodrug that has been shown to inhibit the production of prostaglandins in the brain and spinal cord. This inhibition leads to an increase in cyclic adenosine monophosphate (cAMP) levels which can then reduce the production of proteins in cells. This can have anti-inflammatory effects that are beneficial for people with inflammatory bowel disease or hyperproliferative diseases such as cancer. Mabuprofen has also been shown to decrease the levels of soybean trypsin inhibitor in rats with bowel disease. The mechanism for this activity may be due to its ability to act as a substrate molecule for enzyme reactions, such as soybean trypsin inhibitors.</p>Formula:C15H23NO2Purity:Min. 95%Molecular weight:249.35 g/mol
