CymitQuimica logo

CAS 828241-99-2

:

1-[1-methyl-5-(trifluoromethyl)-1H-benzimidazol-2-yl]methanamine

Description:
1-[1-Methyl-5-(trifluoromethyl)-1H-benzimidazol-2-yl]methanamine, with the CAS number 828241-99-2, is a chemical compound characterized by its unique structure that includes a benzimidazole core substituted with a trifluoromethyl group and a methanamine moiety. This compound typically exhibits properties associated with both aromatic and amine functionalities, which can influence its reactivity and interactions. The presence of the trifluoromethyl group often enhances lipophilicity and can affect the compound's biological activity, making it of interest in pharmaceutical research. Additionally, the benzimidazole framework is known for its diverse applications, particularly in medicinal chemistry, where it can serve as a scaffold for drug development. The compound's solubility, stability, and potential biological effects would depend on its specific molecular interactions and the environment in which it is studied. Overall, this compound represents a class of molecules that may have significant implications in various chemical and biological contexts.
Formula:C10H10F3N3
InChI:InChI=1/C10H10F3N3/c1-16-8-3-2-6(10(11,12)13)4-7(8)15-9(16)5-14/h2-4H,5,14H2,1H3
SMILES:Cn1c2ccc(cc2nc1CN)C(F)(F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.