CymitQuimica logo

CAS 828242-03-1

:

3H-Imidazo[4,5-b]pyridine-2-methanamine

Description:
3H-Imidazo[4,5-b]pyridine-2-methanamine is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. This compound typically exhibits a basic nature due to the presence of the amine group, making it capable of forming salts with acids. It is often studied for its potential biological activities, including roles in medicinal chemistry as a scaffold for drug development. The structure allows for various functionalizations, which can enhance its pharmacological properties. Additionally, its solubility and stability can vary depending on the substituents attached to the core structure. The compound may also exhibit fluorescence, making it useful in certain analytical applications. As with many heterocycles, it may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, which can be leveraged in synthetic organic chemistry. Overall, 3H-Imidazo[4,5-b]pyridine-2-methanamine represents a versatile building block in both academic research and pharmaceutical development.
Formula:C7H8N4
InChI:InChI=1S/C7H8N4/c8-4-6-10-5-2-1-3-9-7(5)11-6/h1-3H,4,8H2,(H,9,10,11)
InChI key:InChIKey=XCTNDJAFNBCVOM-UHFFFAOYSA-N
SMILES:C(N)C=1NC=2C(N1)=NC=CC2
Synonyms:
  • (3H-imidazo[4,5-b]pyridin-2-yl)methanamine
  • 1H-Imidazo[4,5-b]pyridin-2-ylmethanamine
  • 1H-Imidazo[4,5-b]pyridine-2-methanamine
  • 3H-Imidazo[4,5-B]pyridine-2-methanamine
  • [1H-Imidazo[4,5-b]pyridin-2-yl]methanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.