CAS 828299-73-6
:1-(4-Methoxyphenyl)-3-(2-propen-1-yl)-2-thioxo-4-imidazolidinone
Description:
1-(4-Methoxyphenyl)-3-(2-propen-1-yl)-2-thioxo-4-imidazolidinone, with the CAS number 828299-73-6, is a synthetic organic compound characterized by its imidazolidinone core structure, which features a thioxo group and a methoxyphenyl substituent. This compound typically exhibits a range of biological activities, making it of interest in medicinal chemistry. The presence of the methoxy group enhances its lipophilicity, potentially influencing its pharmacokinetic properties. The propenyl group may contribute to its reactivity and ability to participate in various chemical reactions, including those involving nucleophiles. Additionally, the thioxo moiety can impart unique electronic properties, affecting the compound's stability and interaction with biological targets. Overall, this compound's structural features suggest potential applications in drug development, particularly in the search for new therapeutic agents. However, specific properties such as solubility, melting point, and biological activity would require empirical investigation for comprehensive characterization.
Formula:C13H14N2O2S
InChI:InChI=1S/C13H14N2O2S/c1-3-8-14-12(16)9-15(13(14)18)10-4-6-11(17-2)7-5-10/h3-7H,1,8-9H2,2H3
InChI key:InChIKey=HFEWYWYNNWDLGS-UHFFFAOYSA-N
SMILES:S=C1N(CC(=O)N1CC=C)C2=CC=C(OC)C=C2
Synonyms:- 4-Imidazolidinone, 1-(4-methoxyphenyl)-3-(2-propen-1-yl)-2-thioxo-
- 1-(4-Methoxyphenyl)-3-(2-propen-1-yl)-2-thioxo-4-imidazolidinone
- 4-Imidazolidinone, 1-(4-methoxyphenyl)-3-(2-propenyl)-2-thioxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.