CAS 828300-58-9

3-Piperidinecarboxamide, conjugate acid (1:1)

Description:

3-Piperidinecarboxamide, conjugate acid (1:1), identified by its CAS number 828300-58-9, is a chemical compound that features a piperidine ring, which is a six-membered saturated heterocyclic amine. This compound is characterized by the presence of a carboxamide functional group, which contributes to its solubility and reactivity. As a conjugate acid, it typically exists in a protonated form, indicating that it can accept protons, making it a weak acid. The piperidine moiety provides basicity due to the nitrogen atom's lone pair, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. This compound may exhibit biological activity, potentially serving as a pharmacophore in medicinal chemistry. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and the presence of other functional groups. Overall, 3-Piperidinecarboxamide, conjugate acid (1:1) is of interest in both synthetic and medicinal chemistry due to its structural features and potential applications.

Formula: C₆H₁₂N₂O·H

InChI: InChI=1S/C6H12N2O/c7-6(9)5-2-1-3-8-4-5/h5,8H,1-4H2,(H2,7,9)/p+1

InChI key: InChIKey=BVOCPVIXARZNQN-UHFFFAOYSA-O

SMILES: C(N)(=O)C1CCCNC1.[H+]

Synonyms:

• 3-Piperidinecarboxamide, conjugate monoacid
• 3-Piperidinecarboxamide,conjugate monoacid (9CI)
• 3-Piperidinecarboxamide, conjugate acid (1:1)