CymitQuimica logo

CAS 82832-28-8

:

4-butyl-4'-(4-fluorophenyl)-1,1'-bi(cyclohexyl)

Description:
4-butyl-4'-(4-fluorophenyl)-1,1'-bi(cyclohexyl), with the CAS number 82832-28-8, is an organic compound characterized by its complex structure, which includes a bi-cyclohexyl framework and a butyl group along with a fluorophenyl substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential applications in various fields, including materials science and pharmaceuticals. The presence of the fluorine atom can enhance the compound's lipophilicity and influence its electronic properties, making it of interest in medicinal chemistry. Additionally, the bulky cyclohexyl groups may impart steric hindrance, affecting the compound's reactivity and interactions with other molecules. Its solubility, stability, and melting or boiling points would depend on the specific conditions and the nature of the substituents. Overall, this compound's unique structural features suggest potential utility in specialized applications, although detailed experimental data would be necessary to fully characterize its behavior in different environments.
Formula:C22H33F
InChI:InChI=1/C22H33F/c1-2-3-4-17-5-7-18(8-6-17)19-9-11-20(12-10-19)21-13-15-22(23)16-14-21/h13-20H,2-12H2,1H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.