CymitQuimica logo

CAS 82832-72-2

:

(trans,trans)-4′-Propyl[1,1′-bicyclohexyl]-4-ol

Description:
(trans,trans)-4′-Propyl[1,1′-bicyclohexyl]-4-ol, with the CAS number 82832-72-2, is a chemical compound characterized by its bicyclic structure, which consists of two fused cyclohexane rings. This compound features a propyl group and a hydroxyl (-OH) functional group, contributing to its classification as an alcohol. The trans configuration of the substituents indicates that the groups are positioned opposite each other on the bicyclic framework, which can influence its physical and chemical properties, such as boiling point and solubility. The presence of the hydroxyl group suggests that it may exhibit hydrogen bonding, affecting its solubility in polar solvents. Additionally, the compound's structure may impart specific stereochemical properties that can influence its reactivity and interactions with biological systems. Overall, (trans,trans)-4′-Propyl[1,1′-bicyclohexyl]-4-ol is of interest in various fields, including organic chemistry and materials science, due to its unique structural characteristics.
Formula:C15H28O
InChI:InChI=1/C15H28O/c1-2-3-12-4-6-13(7-5-12)14-8-10-15(16)11-9-14/h12-16H,2-11H2,1H3/t12-,13-,14-,15-
InChI key:InChIKey=DFXWFFHIZJDOFZ-KTSLABGINA-N
SMILES:C(CC)[C@H]1CC[C@@](CC1)([C@]2(CC[C@H](O)CC2)[H])[H]
Synonyms:
  • [1,1′-Bicyclohexyl]-4-ol, 4′-propyl-, (trans,trans)-
  • (trans,trans)-4′-Propyl-1,1′-bicyclohexyl-4-ol
  • (trans,trans)-4′-Propyl[1,1′-bicyclohexyl]-4-ol
Found 5 products.