CAS 82846-28-4
:6-(dimethylamino)pyridine-3-carboxylic acid
Description:
6-(Dimethylamino)pyridine-3-carboxylic acid is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxylic acid functional group (-COOH) at the 3-position and a dimethylamino group (-N(CH3)2) at the 6-position of the pyridine ring. The presence of the dimethylamino group enhances its basicity and nucleophilicity, making it useful in various chemical reactions, particularly in organic synthesis and catalysis. The carboxylic acid group contributes to its acidity and solubility in polar solvents. This compound is often utilized as a building block in the synthesis of pharmaceuticals and agrochemicals due to its ability to participate in various chemical transformations. Additionally, it may exhibit biological activity, although specific pharmacological properties would require further investigation. Overall, 6-(dimethylamino)pyridine-3-carboxylic acid is a versatile compound with significant applications in both research and industry.
Formula:C8H10N2O2
InChI:InChI=1/C8H10N2O2/c1-10(2)7-4-3-6(5-9-7)8(11)12/h3-5H,1-2H3,(H,11,12)
SMILES:CN(C)c1ccc(cn1)C(=O)O
Synonyms:- 3-Pyridinecarboxylic Acid, 6-(Dimethylamino)-
- 6-(Dimethylamino)-nicotinic acid
- 6-Dimethylaminopyridine-3-Carboxylic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
6-(Dimethylamino)nicotinic acid
CAS:Formula:C8H10N2O2Purity:97%Color and Shape:SolidMolecular weight:166.17726-(Dimethylamino)nicotinic acid
CAS:6-(Dimethylamino)nicotinic acidPurity:97%Molecular weight:166.18g/mol6-(Dimethylamino)nicotinic acid
CAS:Formula:C8H10N2O2Purity:97%Color and Shape:SolidMolecular weight:166.186-(Dimethylamino)nicotinic acid
CAS:6-(Dimethylamino)nicotinic acid is a fine chemical and research chemical that is useful as a building block for complex compounds. It is also used as a reagent in the synthesis of other chemicals, or as an intermediate or scaffold molecule in organic chemistry. This chemical has been shown to be useful in the synthesis of many drugs, including penicillin and erythromycin. 6-(Dimethylamino)nicotinic acid has CAS number 82846-28-4.
Formula:C8H10N2O2Purity:Min. 95%Color and Shape:White PowderMolecular weight:166.18 g/mol




