CAS 82846-28-4

6-(dimethylamino)pyridine-3-carboxylic acid

Description:

6-(Dimethylamino)pyridine-3-carboxylic acid is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxylic acid functional group (-COOH) at the 3-position and a dimethylamino group (-N(CH3)2) at the 6-position of the pyridine ring. The presence of the dimethylamino group enhances its basicity and nucleophilicity, making it useful in various chemical reactions, particularly in organic synthesis and catalysis. The carboxylic acid group contributes to its acidity and solubility in polar solvents. This compound is often utilized as a building block in the synthesis of pharmaceuticals and agrochemicals due to its ability to participate in various chemical transformations. Additionally, it may exhibit biological activity, although specific pharmacological properties would require further investigation. Overall, 6-(dimethylamino)pyridine-3-carboxylic acid is a versatile compound with significant applications in both research and industry.

Formula: C₈H₁₀N₂O₂

InChI: InChI=1/C8H10N2O2/c1-10(2)7-4-3-6(5-9-7)8(11)12/h3-5H,1-2H3,(H,11,12)

SMILES: CN(C)c1ccc(cn1)C(=O)O

Synonyms:

• 3-Pyridinecarboxylic Acid, 6-(Dimethylamino)-
• 6-(Dimethylamino)-nicotinic acid
• 6-Dimethylaminopyridine-3-Carboxylic Acid

6-(Dimethylamino)nicotinic acid

CAS: 82846-28-4

Formula: C₈H₁₀N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 166.1772

Ref: IN-DA004WXK

6-(Dimethylamino)nicotinic acid

CAS: 82846-28-4

6-(Dimethylamino)nicotinic acid

Purity: 97%

Molecular weight: 166.18g/mol

Ref: 54-OR951947

6-(N,N-Dimethylamino)nicotinic acid

CAS: 82846-28-4

Purity: 99%

Molecular weight: 166.177

Ref: FT-D11094

6-(Dimethylamino)nicotinic acid

CAS: 82846-28-4

Formula: C₈H₁₀N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 166.18

Ref: 10-F234070

6-(Dimethylamino)nicotinic acid

CAS: 82846-28-4

6-(Dimethylamino)nicotinic acid is a fine chemical and research chemical that is useful as a building block for complex compounds. It is also used as a reagent in the synthesis of other chemicals, or as an intermediate or scaffold molecule in organic chemistry. This chemical has been shown to be useful in the synthesis of many drugs, including penicillin and erythromycin. 6-(Dimethylamino)nicotinic acid has CAS number 82846-28-4.

Formula: C₈H₁₀N₂O₂

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 166.18 g/mol

Ref: 3D-FD122894