CAS 82846-48-8

(8E,12Z)-10-hydroxyoctadeca-8,12-dienoic acid

Description:

(8E,12Z)-10-hydroxyoctadeca-8,12-dienoic acid, commonly known as 10-hydroxyoctadecadienoic acid (HODE), is a fatty acid derivative characterized by its unique double bond configuration and hydroxyl group. This compound features a long carbon chain with a total of 18 carbon atoms, including two cis double bonds located at the 8th and 12th positions, which contribute to its unsaturated nature. The presence of the hydroxyl group at the 10th carbon enhances its reactivity and solubility in polar solvents. HODE is known for its biological significance, particularly in the context of lipid metabolism and signaling pathways. It is involved in various physiological processes, including inflammation and cell signaling. Additionally, it can be derived from the oxidation of linoleic acid and is often studied for its potential roles in health and disease. The compound's structural characteristics and functional groups make it a subject of interest in both biochemistry and pharmacology.

Formula: C₁₈H₃₂O₃

InChI: InChI=1/C18H32O3/c1-2-3-4-5-8-11-14-17(19)15-12-9-6-7-10-13-16-18(20)21/h8,11-12,15,17,19H,2-7,9-10,13-14,16H2,1H3,(H,20,21)/b11-8-,15-12+

10-Hydroxy-8(E),12(Z)-octadecadienoic acid

CAS: 82846-48-8

Formula: C18H32O3

Purity: >98%

Color and Shape: In solution, Ethanol

Molecular weight: 296.45

Ref: 48-14-1854