CAS 82864-77-5
:3-Deoxypentaric acid
Description:
3-Deoxypentaric acid, with the CAS number 82864-77-5, is a chemical compound characterized by its unique structure and functional groups. It is classified as a dicarboxylic acid, which means it contains two carboxylic acid (-COOH) groups. This compound is notable for its role in biochemical pathways, particularly in the context of plant metabolism and the synthesis of certain natural products. Its molecular structure includes a pentane backbone, which contributes to its physical properties, such as solubility and melting point. 3-Deoxypentaric acid may exhibit both acidic and polar characteristics, making it reactive in various chemical reactions, including esterification and amidation. Additionally, it can serve as a precursor in organic synthesis, potentially leading to the development of more complex molecules. Understanding its properties is essential for applications in pharmaceuticals, agriculture, and biochemistry, where it may influence metabolic processes or serve as a building block for more complex compounds.
Formula:C5H8O6
InChI:InChI=1S/C5H8O6/c6-2(4(8)9)1-3(7)5(10)11/h2-3,6-7H,1H2,(H,8,9)(H,10,11)
InChI key:InChIKey=FTWPXBYNGOWCHI-UHFFFAOYSA-N
SMILES:C(CC(C(O)=O)O)(C(O)=O)O
Synonyms:- 3-Deoxypentaric acid
- Pentaric acid, 3-deoxy-
- 2,4-Dihydroxyglutaric acid
- Glutaric acid, 2,4-dihydroxy-
- 2,4-Dihydroxypentanedioic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,4-Dihydroxyglutaric Acid-13C2
CAS:Controlled ProductFormula:C2C3H8O6Color and Shape:NeatMolecular weight:166.099
