CAS 82878-23-7
:5,6,7,8-Tetrahydro-7,7-dimethyl-4H-furo[3,2-c]azepine
Description:
5,6,7,8-Tetrahydro-7,7-dimethyl-4H-furo[3,2-c]azepine is a bicyclic compound characterized by its unique fused ring structure, which includes a furan and an azepine moiety. This compound features a tetrahydro configuration, indicating the presence of four hydrogen atoms that saturate the rings, contributing to its stability and reactivity. The dimethyl groups at the 7-position enhance its steric bulk, potentially influencing its biological activity and solubility. The presence of both nitrogen and oxygen atoms in the structure suggests potential for hydrogen bonding and interactions with biological targets. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its CAS number, 82878-23-7, allows for easy identification and retrieval of data related to its synthesis, properties, and applications. Overall, the structural characteristics of 5,6,7,8-Tetrahydro-7,7-dimethyl-4H-furo[3,2-c]azepine position it as a potentially valuable compound in various chemical and pharmaceutical research contexts.
Formula:C10H15NO
InChI:InChI=1S/C10H15NO/c1-10(2)5-9-8(3-4-12-9)6-11-7-10/h3-4,11H,5-7H2,1-2H3
InChI key:InChIKey=MNGRTYNRRYMNCE-UHFFFAOYSA-N
SMILES:CC1(C)CC2=C(CNC1)C=CO2
Synonyms:- 4H-Furo[3,2-c]azepine, 5,6,7,8-tetrahydro-7,7-dimethyl-
- 5,6,7,8-Tetrahydro-7,7-dimethyl-4H-furo[3,2-c]azepine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.