CAS 82894-98-2: 4-(4-Nitrophenyl)-1,2,3-thiadiazole
Description:4-(4-Nitrophenyl)-1,2,3-thiadiazole is an organic compound characterized by its thiadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and one sulfur atom. The presence of a nitrophenyl group at the 4-position of the thiadiazole enhances its electronic properties, making it a potential candidate for various applications in materials science and pharmaceuticals. This compound typically exhibits a yellow crystalline appearance and is known for its stability under standard conditions. It is soluble in organic solvents, which facilitates its use in organic synthesis and as an intermediate in the production of dyes and agrochemicals. The nitro group contributes to its reactivity, allowing for further chemical modifications. Additionally, compounds of this class may exhibit biological activity, making them of interest in medicinal chemistry. Safety data should be consulted, as nitro compounds can pose health risks, and appropriate handling procedures should be followed.
Formula:C8H5N3O2S
InChI:InChI=1/C8H5N3O2S/c12-11(13)7-3-1-6(2-4-7)8-5-14-10-9-8/h1-5H
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 4-(4-NITROPHENYL)-1,2,3-THIADIAZOLE REF: IN-DA003K4SCAS: 82894-98-2 | - - - | To inquire | Mon 05 May 25 |
 | 4-(4-Nitrophenyl)-1,2,3-thiadiazole REF: 3D-FN54145CAS: 82894-98-2 | Min. 95% | - - - | Discontinued product |
4-(4-NITROPHENYL)-1,2,3-THIADIAZOLE
Ref: IN-DA003K4S
| Undefined size | To inquire |
4-(4-Nitrophenyl)-1,2,3-thiadiazole
Ref: 3D-FN54145
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 25g | Discontinued | Request information |
