
CAS 82898-51-9
:5-Methyl-2-(1-methylethyl)-4-hexen-1-ol
Description:
5-Methyl-2-(1-methylethyl)-4-hexen-1-ol, with the CAS number 82898-51-9, is an organic compound characterized by its unique structure, which includes a hexene backbone with a hydroxyl group (-OH) and branched alkyl substituents. This compound is classified as an alcohol due to the presence of the hydroxyl functional group, which contributes to its solubility in polar solvents and influences its reactivity. The presence of the double bond in the hexene structure introduces unsaturation, which can affect its chemical properties, such as reactivity in addition reactions. Additionally, the branched isopropyl group enhances its steric hindrance, potentially influencing its interactions with other molecules. This compound may exhibit interesting olfactory properties, making it relevant in the fragrance and flavor industry. Its stability and reactivity can be influenced by environmental factors such as temperature and pH. Overall, 5-Methyl-2-(1-methylethyl)-4-hexen-1-ol is a versatile compound with applications in various fields, including organic synthesis and materials science.
Formula:C10H20O
InChI:InChI=1S/C10H20O/c1-8(2)5-6-10(7-11)9(3)4/h5,9-11H,6-7H2,1-4H3
InChI key:InChIKey=VPDSPOWDCKVMDL-UHFFFAOYSA-N
SMILES:C(CC=C(C)C)(C(C)C)CO
Synonyms:- 4-Hexen-1-ol, 5-methyl-2-(1-methylethyl)-
- 2-Isopropyl-5-methylhex-4-en-1-ol
- 5-Methyl-2-(1-methylethyl)-4-hexen-1-ol
- 4-Hexen-1-ol, 2-isopropyl-5-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.