CAS 829-26-5

2,3,6-Trimethylnaphthalene

Description:

2,3,6-Trimethylnaphthalene is an organic compound belonging to the naphthalene family, characterized by its polycyclic aromatic structure. It features three methyl groups attached to the naphthalene ring system, specifically at the 2, 3, and 6 positions. This compound is typically a colorless to pale yellow liquid or solid, depending on temperature, and has a distinctive aromatic odor. It is relatively insoluble in water but soluble in organic solvents, reflecting its hydrophobic nature. 2,3,6-Trimethylnaphthalene is known for its stability and resistance to oxidation, making it useful in various applications, including as a solvent, in the production of dyes, and as a chemical intermediate in organic synthesis. Its physical properties, such as boiling point and melting point, are influenced by the presence of the methyl groups, which affect the compound's volatility and crystallization behavior. Additionally, like other polycyclic aromatic hydrocarbons, it may pose environmental and health risks, necessitating careful handling and regulation.

Formula: C₁₃H₁₄

InChI: InChI=1S/C13H14/c1-9-4-5-12-7-10(2)11(3)8-13(12)6-9/h4-8H,1-3H3

InChI key: InChIKey=UNBZRJCHIWTUHB-UHFFFAOYSA-N

SMILES: CC1=CC2=C(C=C1C)C=CC(C)=C2

Synonyms:

• Ai3-17611
• Naphthalene, 2,3,6-trimethyl-
• Naphthalene, 2,3,6-trimethyl- (8CI)(9CI)
• Nsc 11848
• 2,3,6-Trimethylnaphthalene

2,3,6-Trimethylnaphthalene

Controlled Product

CAS: 829-26-5

Formula: C₁₃H₁₄

Color and Shape: Neat

Molecular weight: 170.25

Ref: TR-T219660