CymitQuimica logo

CAS 829-40-3

:

1-fluoro-2-[(1E)-2-nitroprop-1-en-1-yl]benzene

Description:
1-Fluoro-2-[(1E)-2-nitroprop-1-en-1-yl]benzene, with the CAS number 829-40-3, is an organic compound characterized by the presence of a fluorine atom and a nitro-substituted alkene group attached to a benzene ring. This compound features a fluoro group at the 1-position and a nitropropene moiety at the 2-position of the benzene, contributing to its reactivity and potential applications in organic synthesis. The presence of the nitro group enhances the electrophilic character of the molecule, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound's structure suggests it may exhibit interesting electronic properties due to the conjugation between the nitro group and the aromatic system. Its physical properties, such as boiling point, melting point, and solubility, would depend on the specific interactions of the functional groups present. Overall, 1-fluoro-2-[(1E)-2-nitroprop-1-en-1-yl]benzene is a valuable compound in the field of synthetic organic chemistry.
Formula:C9H8FNO2
InChI:InChI=1/C9H8FNO2/c1-7(11(12)13)6-8-4-2-3-5-9(8)10/h2-6H,1H3/b7-6+
Synonyms:
  • 1-Fluoro-2-[(1E)-2-nitro-1-propen-1-yl]benzene
  • benzene, 1-fluoro-2-[(1E)-2-nitro-1-propen-1-yl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.