CAS 829-84-5

Dicyclohexylphosphine

Description:

Dicyclohexylphosphine (CAS 829-84-5) is an organophosphorus compound characterized by its two cyclohexyl groups attached to a phosphorus atom. It appears as a colorless to pale yellow liquid and is known for its distinctive odor. This compound is soluble in organic solvents but has limited solubility in water. Dicyclohexylphosphine is primarily used as a ligand in coordination chemistry and catalysis, particularly in the formation of metal complexes. Its sterically bulky cyclohexyl groups provide unique properties that enhance the stability and reactivity of metal-ligand complexes. Additionally, it can act as a reducing agent and is involved in various organic synthesis reactions. Safety considerations include handling it in a well-ventilated area and using appropriate personal protective equipment, as it may cause irritation upon contact with skin or eyes. Overall, dicyclohexylphosphine is a valuable compound in synthetic chemistry and materials science due to its versatile reactivity and coordination properties.

Formula: C₁₂H₂₃P

InChI: InChI=1S/C12H23P/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h11-13H,1-10H2

InChI key: InChIKey=HDULBKVLSJEMGN-UHFFFAOYSA-N

SMILES: P(C1CCCCC1)C2CCCCC2

Synonyms:

• Dicyclohexyl phosphine
• Dicyclohexylphosphane
• Phosphine, dicyclohexyl-
• Dicyclohexylphosphine

Dicyclohexylphosphine, 98% (10 wt% in hexanes)

CAS: 829-84-5

Dicyclohexylphosphine, 98% (10 wt% in hexanes)

Formula: (C₆H₁₁)₂PH

Purity: 98%

Color and Shape: colorless liq.

Molecular weight: 198.29

Ref: 08-15-1122

Dicyclohexylphosphine, 98%

CAS: 829-84-5

Dicyclohexylphosphine, 98%

Formula: (C₆H₁₁)₂PH

Purity: 98%

Color and Shape: light orange yellow liq.

Molecular weight: 198.29

Ref: 08-15-1120

Dicyclohexylphosphine

CAS: 829-84-5

Dicyclohexylphosphine is a heterocycle that forms complexes with palladium. It has been shown to form a variety of compounds with other elements, including an antimicrobial agent used for the treatment of urinary tract infections. Dicyclohexylphosphine is also known as Pd(PPh2)2, which is a common ligand in organometallic chemistry. This compound has been shown to inhibit the growth of bacteria such as E. coli and Proteus mirabilis by preventing glucose uptake. Dicyclohexylphosphine is also an effective catalyst for transfer reactions between aryl halides and sodium-dependent glucose, which may be due to its ability to bind chlorine atoms in the substrate molecule. The molecular weight of dicyclohexylphosphine is 164.17 g/mol and it has a melting point of 128°C (260°F). The compound has been found to have an N

Formula: C₁₂H₂₃P

Purity: Min. 95%

Molecular weight: 198.28 g/mol

Ref: 3D-AAA82984