CAS 82911-32-8

1-Butanesulfonic acid, 4-[(4,5-dihydro-5-thioxo-1,3,4-thiadiazol-2-yl)thio]-, sodium salt (1:1)

Description:

1-Butanesulfonic acid, 4-[(4,5-dihydro-5-thioxo-1,3,4-thiadiazol-2-yl)thio]-, sodium salt (1:1), with CAS number 82911-32-8, is a chemical compound characterized by its sulfonic acid functional group, which imparts strong acidity and solubility in water. This compound features a butanesulfonic acid moiety, contributing to its properties as a surfactant or solubilizing agent. The presence of the thiazole derivative enhances its biological activity, potentially making it useful in pharmaceutical applications or as a reagent in organic synthesis. As a sodium salt, it is likely to exhibit good stability and solubility in aqueous solutions, which is advantageous for various applications in chemical and biological contexts. The compound may also possess specific reactivity due to the thiazole ring, allowing for further functionalization or interaction with other chemical species. Overall, this compound's unique structure and functional groups suggest potential utility in both industrial and research settings, particularly in fields related to biochemistry and medicinal chemistry.

Formula: C₆H₁₀N₂O₃S₄·Na

InChI: InChI=1S/C6H10N2O3S4.Na/c9-15(10,11)4-2-1-3-13-6-8-7-5(12)14-6;/h1-4H2,(H,7,12)(H,9,10,11);

InChI key: InChIKey=FHPKXGCCYKHZRB-UHFFFAOYSA-N

SMILES: S(CCCCS(=O)(=O)O)C1=NNC(=S)S1.[Na]

Synonyms:

• 1-Butanesulfonic acid, 4-[(4,5-dihydro-5-thioxo-1,3,4-thiadiazol-2-yl)thio]-, sodium salt (1:1)
• 1-Butanesulfonic acid, 4-[(4,5-dihydro-5-thioxo-1,3,4-thiadiazol-2-yl)thio]-, monosodium salt