CAS 82911-60-2
:1,4,6-trichlorodibenzo[b,d]furan
Description:
1,4,6-Trichlorodibenzo[b,d]furan is a synthetic organic compound characterized by its complex polycyclic structure, which consists of two fused benzene rings and a furan ring, with three chlorine substituents at the 1, 4, and 6 positions. This compound is typically a solid at room temperature and is known for its stability and resistance to degradation. It is often studied for its potential environmental impact, particularly as a persistent organic pollutant due to its chlorinated nature. The presence of chlorine atoms enhances its lipophilicity, which can lead to bioaccumulation in living organisms. Additionally, 1,4,6-trichlorodibenzo[b,d]furan may exhibit toxicological effects, making it a subject of concern in environmental chemistry and toxicology. Its synthesis and degradation pathways are of interest in research focused on pollution and remediation strategies. Overall, this compound exemplifies the complexities associated with halogenated organic compounds in terms of their environmental behavior and potential health risks.
Formula:C12H5Cl3O
InChI:InChI=1/C12H5Cl3O/c13-7-4-5-9(15)12-10(7)6-2-1-3-8(14)11(6)16-12/h1-5H
SMILES:c1cc2c3c(ccc(c3oc2c(c1)Cl)Cl)Cl
Synonyms:- 1,4,6-Trichlorodibenzofuran
- Dibenzofuran, 1,4,6-trichloro
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.