CymitQuimica logo

CAS 82911-79-3

:

L-Tyrosine,N-[(9H-fluoren-9-ylmethoxy)carbonyl]-, methyl ester

Description:
L-Tyrosine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-, methyl ester, commonly referred to as Fmoc-Tyrosine methyl ester, is a derivative of the amino acid tyrosine. It features a fluorenylmethoxycarbonyl (Fmoc) protecting group, which is widely used in peptide synthesis to protect the amino group during the formation of peptide bonds. This compound is characterized by its stability under basic conditions and its ability to be deprotected under mild acidic conditions, allowing for selective cleavage of the Fmoc group when desired. The methyl ester functionality enhances its lipophilicity, facilitating its incorporation into various organic reactions and peptide synthesis protocols. Fmoc-Tyrosine methyl ester is typically utilized in solid-phase peptide synthesis, where it serves as a building block for the assembly of peptides. Its structure includes a phenolic hydroxyl group, which can participate in hydrogen bonding and contribute to the compound's solubility in organic solvents. Overall, this compound is valuable in the field of organic chemistry and biochemistry for its role in synthesizing complex peptides and proteins.
Formula:C25H23NO5
InChI:InChI=1S/C25H23NO5/c1-30-24(28)23(14-16-10-12-17(27)13-11-16)26-25(29)31-15-22-20-8-4-2-6-18(20)19-7-3-5-9-21(19)22/h2-13,22-23,27H,14-15H2,1H3,(H,26,29)/t23-/m0/s1
InChI key:NWIXWDJMIUGINH-QHCPKHFHSA-N
SMILES:COC(=O)[C@H](CC1=CC=C(C=C1)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24
Synonyms:
  • Fmoc-Tyr-OMe
Found 4 products.